Compound Q&A

How should 2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid (CAS: 4818-59-1) be stored?

Answer

2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid
2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid (CAS: 4818-59-1) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to protect it from moisture and air exposure.

About

CAS No 4818-59-1
English Name 2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid
Molecular Formula C12H11ClN2O5S
Molecular Weight 330.75 g/mol
SMILES C1=COC(=C1)CNC2=C(C=C(C(=C2)Cl)C(=O)O)S(=O)(=O)N
InChIKey UXOOVYKVEXGCSH-UHFFFAOYSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What is 2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid (CAS: 4818-59-1)?

2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid (CAS: 4818-59-1) is a chemical compound wi...

Compound Q&A

What are the main uses of 2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid (CAS: 4818-59-1)?

2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid (CAS: 4818-59-1) is primarily used in phar...

Compound Q&A

Is 2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid (CAS: 4818-59-1) safe?

2-Chloro-4-[(2-furylmethyl)amino]-5-sulfamoylbenzoic acid (CAS: 4818-59-1) is generally safe under n...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...