Compound Q&A

What is 4-[4-({[2-Chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methyl-2-pyridinecarboxamide (CAS: 1431697-81-2)?

Answer

4-[4-({[2-Chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methyl-2-pyridinecarboxamide
This compound, known as 4-[4-({[2-Chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methyl-2-pyridinecarboxamide (CAS: 1431697-81-2), is a complex organic molecule characterized by its aromatic and amide structures. It is used primarily in pharmaceutical research for its potential biological activity.

About

English Name 4-[4-({[2-Chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methyl-2-pyridinecarboxamide
Molecular Formula C21H16ClF3N4O3
Molecular Weight 464.83 g/mol
SMILES CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3cccc(c3Cl)C(F)(F)F)cc2)ccn1
InChIKey JWAKXXCHFJSKRN-UHFFFAOYSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What are the main uses of 4-[4-({[2-Chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methyl-2-pyridinecarboxamide (CAS: 1431697-81-2)?

The main use of this compound is in pharmaceutical research, where it serves as a probe molecule for...

Compound Q&A

Is 4-[4-({[2-Chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methyl-2-pyridinecarboxamide (CAS: 1431697-81-2) safe?

This compound should be handled with caution due to its chemical complexity and potential reactivity...

Compound Q&A

How should 4-[4-({[2-Chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methyl-2-pyridinecarboxamide (CAS: 1431697-81-2) be stored?

This compound should be stored in a tightly sealed container at room temperature (15-25°C), away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...