Related Q&A
What is N-(2-Nitrophenyl)phosphoric triamide (CAS: 874819-71-3)?
N-(2-Nitrophenyl)phosphoric triamide is an organic compound (CAS: 874819-71-3) characterized by its ...
Is N-(2-Nitrophenyl)phosphoric triamide (CAS: 874819-71-3) safe?
N-(2-Nitrophenyl)phosphoric triamide (CAS: 874819-71-3) is generally safe when handled properly. How...
How should N-(2-Nitrophenyl)phosphoric triamide (CAS: 874819-71-3) be stored?
N-(2-Nitrophenyl)phosphoric triamide (CAS: 874819-71-3) should be stored in a dry and cool place, aw...
What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?
6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...
What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?
4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...
What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?
2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...
What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?
2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...



