Compound Q&A

What is 5,6-Diamino-1,3-naphthalenedisulfonic acid (CAS: 73692-57-6)?

Answer

5,6-Diamino-1,3-naphthalenedisulfonic acid
5,6-Diamino-1,3-naphthalenedisulfonic acid is a water-soluble, colorless to pale yellow crystalline compound. It is used in pH indicators, dyes, and as a surfactant. It has a molecular formula of C14H8N2O4S2 and is known for its stability in various pH conditions.

About

CAS No 73692-57-6
English Name 5,6-Diamino-1,3-naphthalenedisulfonic acid
Molecular Formula C10H10N2O6S2
Molecular Weight 318.33 g/mol
SMILES C1=CC(=C(C2=C1C(=CC(=C2)S(=O)(=O)O)S(=O)(=O)O)N)N
InChIKey KHEHRJJAWUJGDW-UHFFFAOYSA-N
Last Updated: 2025-12-24 16:21

Related Q&A

Compound Q&A

What are the main uses of 5,6-Diamino-1,3-naphthalenedisulfonic acid (CAS: 73692-57-6)?

This compound is primarily used as a pH indicator in analytical chemistry, in the production of dyes...

Compound Q&A

Is 5,6-Diamino-1,3-naphthalenedisulfonic acid (CAS: 73692-57-6) safe?

The compound is generally considered safe for laboratory use with appropriate handling practices. Ho...

Compound Q&A

How should 5,6-Diamino-1,3-naphthalenedisulfonic acid (CAS: 73692-57-6) be stored?

Store the compound in a cool, dry place away from direct sunlight and heat sources. It should be kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...