Compound Q&A

Is 1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid (CAS: 152305-87-8) safe?

Answer

1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid
1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid is generally considered safe when handled with appropriate precautions. However, it is important to follow safety guidelines, such as wearing protective gloves, glasses, and a lab coat, and avoiding contact with skin and eyes. It should be stored away from heat and fire sources.

About

English Name 1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid
Molecular Formula C6H7NO7S
Molecular Weight 237.19 g/mol
SMILES CC(=O)ON1C(=O)CC(C1=O)S(=O)(=O)O
InChIKey MDUQWFYJHRLNRN-UHFFFAOYSA-N
Last Updated: 2025-12-24 12:09

Related Q&A

Compound Q&A

What is 1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid (CAS: 152305-87-8)?

1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid is a chemical compound with the CAS number 152305-87-...

Compound Q&A

What are the main uses of 1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid (CAS: 152305-87-8)?

1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid is primarily used in pharmaceuticals for the synthesi...

Compound Q&A

How should 1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid (CAS: 152305-87-8) be stored?

1-Acetoxy-2,5-dioxo-3-pyrrolidinesulfonic acid should be stored in a cool, dry place, away from heat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...