Compound Q&A

What are the main uses of N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide (CAS: 97963-75-2)?

Answer

N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide
N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide is primarily used as an intermediate in the synthesis of pharmaceuticals and other organic compounds. It is also utilized in research for its chemical properties and potential applications in various industries due to its structural features.

About

CAS No 97963-75-2
English Name N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide
Molecular Formula C9H8F2N2O4
Molecular Weight 246.17 g/mol
SMILES CC(=O)NC1=C(C=C(C=C1)OC(F)F)[N+](=O)[O-]
InChIKey QEQJDPGRNSQLFI-UHFFFAOYSA-N
Last Updated: 2025-12-24 12:09

Related Q&A

Compound Q&A

What is N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide (CAS: 97963-75-2)?

N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide is a chemical compound with the CAS number 97963-75-2...

Compound Q&A

Is N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide (CAS: 97963-75-2) safe?

N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide is generally considered safe when handled under prope...

Compound Q&A

How should N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide (CAS: 97963-75-2) be stored?

N-(4-(Difluoromethoxy)-2-nitrophenyl)acetamide should be stored in a cool, dry place away from direc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...