Compound Q&A

What are the main uses of Phenyl 1-thio-alpha-D-mannopyranoside (CAS: 77481-62-0)?

Answer

Phenyl 1-thio-alpha-D-mannopyranoside
Phenyl 1-thio-alpha-D-mannopyranoside (CAS: 77481-62-0) is primarily used in pharmaceutical research for its potential as a carbohydrate derivative. It is also utilized in the synthesis of other complex carbohydrates and in the development of new therapeutics. Additionally, it can be used in academic research for carbohydrate chemistry and medicinal chemistry studies.

About

CAS No 77481-62-0
English Name Phenyl 1-thio-alpha-D-mannopyranoside
Molecular Formula C12H16O5S
Molecular Weight 272.32 g/mol
SMILES C1=CC=C(C=C1)SC2C(C(C(C(O2)CO)O)O)O
InChIKey OVLYAISOYPJBLU-LDMBFOFVSA-N
Last Updated: 2025-12-22 00:06

Related Q&A

Compound Q&A

What is Phenyl 1-thio-alpha-D-mannopyranoside (CAS: 77481-62-0)?

Phenyl 1-thio-alpha-D-mannopyranoside (CAS: 77481-62-0) is a chemical compound with a thioether link...

Compound Q&A

Is Phenyl 1-thio-alpha-D-mannopyranoside (CAS: 77481-62-0) safe?

Phenyl 1-thio-alpha-D-mannopyranoside (CAS: 77481-62-0) is considered safe for laboratory use when h...

Compound Q&A

How should Phenyl 1-thio-alpha-D-mannopyranoside (CAS: 77481-62-0) be stored?

Phenyl 1-thio-alpha-D-mannopyranoside (CAS: 77481-62-0) should be stored in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...