Compound Q&A

How should 5-Bromo-4-fluoro-2-methoxybenzoic acid (CAS: 95383-26-9) be stored?

Answer

5-Bromo-4-fluoro-2-methoxybenzoic acid
5-Bromo-4-fluoro-2-methoxybenzoic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in tightly sealed containers to prevent moisture absorption. Storage temperature should be below 25°C (77°F) to maintain stability and purity.

About

CAS No 95383-26-9
English Name 5-Bromo-4-fluoro-2-methoxybenzoic acid
Molecular Formula C8H6BrFO3
Molecular Weight 249.04 g/mol
SMILES COC1=CC(=C(C=C1C(=O)O)Br)F
InChIKey OQXNSLHCYIUEDO-UHFFFAOYSA-N
Last Updated: 2025-12-22 00:06

Related Q&A

Compound Q&A

What is 5-Bromo-4-fluoro-2-methoxybenzoic acid (CAS: 95383-26-9)?

5-Bromo-4-fluoro-2-methoxybenzoic acid (CAS: 95383-26-9) is a chemical compound with the molecular f...

Compound Q&A

What are the main uses of 5-Bromo-4-fluoro-2-methoxybenzoic acid (CAS: 95383-26-9)?

5-Bromo-4-fluoro-2-methoxybenzoic acid is primarily used as an intermediate in the synthesis of phar...

Compound Q&A

Is 5-Bromo-4-fluoro-2-methoxybenzoic acid (CAS: 95383-26-9) safe?

5-Bromo-4-fluoro-2-methoxybenzoic acid is generally considered safe for industrial use, but appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...