Compound Q&A

What is 3-Bromo-6-chloro-4-nitro-1H-indazole (CAS: 885519-92-6)?

Answer

3-Bromo-6-chloro-4-nitro-1H-indazole
3-Bromo-6-chloro-4-nitro-1H-indazole (CAS: 885519-92-6) is a complex organic compound featuring a fused ring system with a nitrogen atom and various halogen and nitro substituents. This compound is typically used in the synthesis of other pharmaceuticals and organic intermediates.

About

English Name 3-Bromo-6-chloro-4-nitro-1H-indazole
Molecular Formula C7H3BrClN3O2
Molecular Weight 276.47 g/mol
SMILES C1=C(C=C(C2=C(NN=C21)Br)[N+](=O)[O-])Cl
InChIKey HMTZZHGVKDVBPI-UHFFFAOYSA-N
Last Updated: 2025-12-22 00:06

Related Q&A

Compound Q&A

What are the main uses of 3-Bromo-6-chloro-4-nitro-1H-indazole (CAS: 885519-92-6)?

3-Bromo-6-chloro-4-nitro-1H-indazole (CAS: 885519-92-6) serves as a key intermediate in the pharmace...

Compound Q&A

Is 3-Bromo-6-chloro-4-nitro-1H-indazole (CAS: 885519-92-6) safe?

3-Bromo-6-chloro-4-nitro-1H-indazole (CAS: 885519-92-6) can be handled safely with appropriate preca...

Compound Q&A

How should 3-Bromo-6-chloro-4-nitro-1H-indazole (CAS: 885519-92-6) be stored?

3-Bromo-6-chloro-4-nitro-1H-indazole (CAS: 885519-92-6) should be stored in closed containers in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...