Compound Q&A

How should (3R)-3-amino-3-(3-fluorophenyl)propanoic acid (CAS: 723284-81-9) be stored?

Answer

(3R)-3-amino-3-(3-fluorophenyl)propanoic acid
(3R)-3-amino-3-(3-fluorophenyl)propanoic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. The storage temperature should be maintained between 15-25°C (59-77°F) to ensure stability and quality. Avoid contact with oxidizing agents and incompatible materials to minimize the risk of chemical reactions and degradation.

About

English Name (3R)-3-amino-3-(3-fluorophenyl)propanoic acid
Molecular Formula C9H10FNO2
Molecular Weight 183.18 g/mol
SMILES C1=CC(=CC(=C1)F)C(CC(=O)O)N
InChIKey GZNJUJNKZBHINS-MRVPVSSYSA-N
Last Updated: 2025-12-21 19:11

Related Q&A

Compound Q&A

What is (3R)-3-amino-3-(3-fluorophenyl)propanoic acid (CAS: 723284-81-9)?

(3R)-3-amino-3-(3-fluorophenyl)propanoic acid, also known as fluorophenylalanine, is an organic comp...

Compound Q&A

What are the main uses of (3R)-3-amino-3-(3-fluorophenyl)propanoic acid (CAS: 723284-81-9)?

(3R)-3-amino-3-(3-fluorophenyl)propanoic acid is primarily used in the synthesis of pharmaceuticals,...

Compound Q&A

Is (3R)-3-amino-3-(3-fluorophenyl)propanoic acid (CAS: 723284-81-9) safe?

(3R)-3-amino-3-(3-fluorophenyl)propanoic acid is generally safe when handled with proper precautions...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...