Compound Q&A

What is 5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione (CAS: 6015-57-2)?

Answer

5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione
5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione is a heterocyclic compound with the CAS number 6015-57-2. It is characterized by its aromatic ring structure, featuring a chlorine atom and a nitro group, which give it unique chemical properties and reactivity patterns. This compound is commonly used in the synthesis of organic compounds and pharmaceuticals due to its functional groups.

About

CAS No 6015-57-2
English Name 5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione
Molecular Formula C8H3ClN2O4
Molecular Weight 226.57 g/mol
SMILES C1=C2C(=CC(=C1[N+](=O)[O-])Cl)C(=O)NC2=O
InChIKey ADLVDYMTBOSDFE-UHFFFAOYSA-N
Last Updated: 2025-12-21 19:11

Related Q&A

Compound Q&A

What are the main uses of 5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione (CAS: 6015-57-2)?

5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione is primarily used in the pharmaceutical industry as an i...

Compound Q&A

Is 5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione (CAS: 6015-57-2) safe?

5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione is generally safe when handled with appropriate precauti...

Compound Q&A

How should 5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione (CAS: 6015-57-2) be stored?

5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione should be stored in a cool, dry, and well-ventilated are...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...