Compound Q&A

What is 1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine (CAS: 694499-24-6)?

Answer

1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine
1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine is a chemical compound with the CAS number 694499-24-6. It is a piperazine derivative with a complex molecular structure. This compound is known for its stability and specific chemical properties, making it suitable for various applications in research and industry.

About

English Name 1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine
Molecular Formula C13H16F3N3O2
Molecular Weight 303.28 g/mol
SMILES CN1CCN(CC1)CC2=C(C=C(C=C2)[N+](=O)[O-])C(F)(F)F
InChIKey LIHFIIDGPWSVCX-UHFFFAOYSA-N
Last Updated: 2025-12-21 19:11

Related Q&A

Compound Q&A

What are the main uses of 1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine (CAS: 694499-24-6)?

1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine is primarily used in pharmaceutical researc...

Compound Q&A

Is 1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine (CAS: 694499-24-6) safe?

1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine can be safe when handled properly. However,...

Compound Q&A

How should 1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine (CAS: 694499-24-6) be stored?

1-Methyl-4-[4-nitro-2-(trifluoromethyl)benzyl]piperazine should be stored in a cool, dry place away ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...