Compound Q&A

What are the main uses of H-Arg-OtBu 2HCl (CAS: 87459-72-1)?

Answer

H-Arg-OtBu 2HCl
H-Arg-OtBu 2HCl (CAS: 87459-72-1) is primarily used in chemical synthesis, particularly in the development of peptide drugs. It serves as a protecting group in the synthesis of peptides and other biomolecules, facilitating the introduction of functional groups without interference from the primary amine of the amino acid.

About

CAS No 87459-72-1
English Name H-Arg-OtBu 2HCl
Molecular Formula C10H24Cl2N4O2
Molecular Weight 303.23 g/mol
SMILES CC(C)(C)OC(=O)C(CCCN=C(N)N)N.Cl.Cl
InChIKey QTFOKKSRMYGTQT-KLXURFKVSA-N
Last Updated: 2025-12-21 19:11

Related Q&A

Compound Q&A

What is H-Arg-OtBu 2HCl (CAS: 87459-72-1)?

H-Arg-OtBu 2HCl (CAS: 87459-72-1) is a chemical compound derived from arginine with a tert-butyloxyc...

Compound Q&A

Is H-Arg-OtBu 2HCl (CAS: 87459-72-1) safe?

H-Arg-OtBu 2HCl (CAS: 87459-72-1) is generally considered safe when handled with appropriate precaut...

Compound Q&A

How should H-Arg-OtBu 2HCl (CAS: 87459-72-1) be stored?

H-Arg-OtBu 2HCl (CAS: 87459-72-1) should be stored in a cool, dry place, away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...