Compound Q&A

What industries use [1-(Diphenylmethyl)-3-azetidinyl]methanol (CAS: 72351-36-1)?

Answer

[1-(Diphenylmethyl)-3-azetidinyl]methanol
[1-(Diphenylmethyl)-3-azetidinyl]methanol finds applications in various industries. It is used in the pharmaceutical sector for the synthesis of certain drugs due to its unique chemical structure. In the polymer industry, it serves as a monomer or a building block for the development of new polymers. Additionally, it has potential uses in sensor technology and semiconductor manufacturing for specific chemical reactivity and stability characteristics.

About

CAS No 72351-36-1
English Name [1-(Diphenylmethyl)-3-azetidinyl]methanol
Molecular Formula C17H19NO
Molecular Weight 253.35 g/mol
SMILES C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)CO
InChIKey GEFUGGQLCNKIQP-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of [1-(Diphenylmethyl)-3-azetidinyl]methanol (CAS: 72351-36-1)?

[1-(Diphenylmethyl)-3-azetidinyl]methanol is a colorless or white crystalline solid with a molecular...

Compound Q&A

How is [1-(Diphenylmethyl)-3-azetidinyl]methanol (CAS: 72351-36-1) typically synthesized?

[1-(Diphenylmethyl)-3-azetidinyl]methanol is usually synthesized via a multistep process, starting w...

Compound Q&A

What precautions should be taken when handling [1-(Diphenylmethyl)-3-azetidinyl]methanol (CAS: 72351-36-1)?

When handling [1-(Diphenylmethyl)-3-azetidinyl]methanol (CAS: 72351-36-1), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...