Compound Q&A

What are the physical and chemical properties of 1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone (CAS: 861841-90-9)?

Answer

1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone
1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone is a white crystalline solid with a molecular weight of approximately 365.34 g/mol. It has a slight solubility in water and organic solvents. This compound is reactive, particularly towards nucleophiles and bases, making it suitable for various chemical transformations.

About

English Name 1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone
Molecular Formula C15H15NO3
Molecular Weight 257.29 g/mol
SMILES CC(=O)c1cc(cc(c1O)N)OCc2ccccc2
InChIKey VHNDAASEYRABBJ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is 1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone (CAS: 861841-90-9) typically synthesized?

1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone can be synthesized via the reaction of a phenol de...

Compound Q&A

What industries use 1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone (CAS: 861841-90-9)?

1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone (CAS: 861841-90-9)?

When handling 1-[3-Amino-5-(benzyloxy)-2-hydroxyphenyl]ethanone, it is important to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...