Compound Q&A

What precautions should be taken when handling 5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione (CAS: 68930-97-2)?

Answer

5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione
When handling 5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to the compound. Spills should be cleaned up immediately using appropriate absorbents, and the area should be thoroughly rinsed with water. Always refer to the safety data sheet (SDS) for detailed handling instructions.

About

CAS No 68930-97-2
English Name 5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione
Molecular Formula C12H14N2O2
Molecular Weight 218.26 g/mol
SMILES CCCCN1C(=O)C2=C(C1=O)C=C(C=C2)N
InChIKey HCVCNKOLEMUCHT-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione (CAS: 68930-97-2)?

5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione is a white crystalline solid with a molecular weight of a...

Compound Q&A

How is 5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione (CAS: 68930-97-2) typically synthesized?

5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione is typically synthesized through a multistep reaction inv...

Compound Q&A

What industries use 5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione (CAS: 68930-97-2)?

5-Amino-2-butyl-1H-isoindole-1,3(2H)-dione finds applications in the pharmaceutical industry for the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...