Compound Q&A

What is 2-(4-Methoxy-2-nitrophenyl)acetonitrile (CAS: 105003-90-5)?

Answer

2-(4-Methoxy-2-nitrophenyl)acetonitrile
2-(4-Methoxy-2-nitrophenyl)acetonitrile is a colorless to light yellow liquid with the CAS number 105003-90-5. It has a molecular formula of C9H8N2O3 and a molecular weight of 200.18 g/mol. This compound is used as a precursor in the synthesis of various organic compounds and pharmaceuticals due to its functional groups.

About

English Name 2-(4-Methoxy-2-nitrophenyl)acetonitrile
Molecular Formula C9H8N2O3
Molecular Weight 17.031 g/mol
SMILES COC1=CC(=C(C=C1)CC#N)[N+](=O)[O-]
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the main uses of 2-(4-Methoxy-2-nitrophenyl)acetonitrile (CAS: 105003-90-5)?

2-(4-Methoxy-2-nitrophenyl)acetonitrile (CAS: 105003-90-5) is primarily used as a chemical intermedi...

Compound Q&A

Is 2-(4-Methoxy-2-nitrophenyl)acetonitrile (CAS: 105003-90-5) safe?

2-(4-Methoxy-2-nitrophenyl)acetonitrile (CAS: 105003-90-5) is generally safe when handled with appro...

Compound Q&A

How should 2-(4-Methoxy-2-nitrophenyl)acetonitrile (CAS: 105003-90-5) be stored?

2-(4-Methoxy-2-nitrophenyl)acetonitrile (CAS: 105003-90-5) should be stored in a cool, dry place, pr...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...
Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...
Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...
Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...