Compound Q&A

What are the main uses of Tert-butyl 4-fluoro-2-nitrobenzoate (CAS: 942271-60-5)?

Answer

Tert-butyl 4-fluoro-2-nitrobenzoate
Tert-butyl 4-fluoro-2-nitrobenzoate (CAS: 942271-60-5) is primarily used in the pharmaceutical industry as an intermediate for the synthesis of medicinal compounds. It also finds applications in research and development for its specific chemical properties.

About

English Name Tert-butyl 4-fluoro-2-nitrobenzoate
Molecular Formula C11H12FNO4
Molecular Weight 241.22 g/mol
SMILES CC(C)(C)OC(=O)C1=C(C=C(C=C1)F)[N+](=O)[O-]
InChIKey JLGPJOUWLXCECT-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What is Tert-butyl 4-fluoro-2-nitrobenzoate (CAS: 942271-60-5)?

Tert-butyl 4-fluoro-2-nitrobenzoate (CAS: 942271-60-5) is an organic compound with a unique structur...

Compound Q&A

Is Tert-butyl 4-fluoro-2-nitrobenzoate (CAS: 942271-60-5) safe?

Tert-butyl 4-fluoro-2-nitrobenzoate (CAS: 942271-60-5) is generally safe when used under proper cond...

Compound Q&A

How should Tert-butyl 4-fluoro-2-nitrobenzoate (CAS: 942271-60-5) be stored?

Tert-butyl 4-fluoro-2-nitrobenzoate (CAS: 942271-60-5) should be stored in a cool, dry place, away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...