Compound Q&A

What is (2R)-N~4~-Hydroxy-N~1~-{(2S)-1-[(2S)-2-(hydroxymethyl)-1-pyrrolidinyl]-3-methyl-1-oxo-2-butanyl}-2-pentylsuccinamide (CAS: 13434-13-4)?

Answer

(2R)-N~4~-Hydroxy-N~1~-{(2S)-1-[(2S)-2-(hydroxymethyl)-1-pyrrolidinyl]-3-methyl-1-oxo-2-butanyl}-2-pentylsuccinamide
This compound is a specific chemical structure with a complex molecular formula. It is a derivative of succinamide featuring a hydroxyl group at the N4 position and a unique substituent on the 2-pentyl group. It possesses amphipathic properties, making it suitable for various applications in pharmaceuticals and research.

About

CAS No 13434-13-4
English Name (2R)-N~4~-Hydroxy-N~1~-{(2S)-1-[(2S)-2-(hydroxymethyl)-1-pyrrolidinyl]-3-methyl-1-oxo-2-butanyl}-2-pentylsuccinamide
Molecular Formula C19H35N3O5
Molecular Weight 385.51 g/mol
SMILES CCCCCC(CC(=O)NO)C(=O)NC(C(C)C)C(=O)N1CCCC1CO
InChIKey XJLATMLVMSFZBN-VYDXJSESSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the main uses of (2R)-N~4~-Hydroxy-N~1~-{(2S)-1-[(2S)-2-(hydroxymethyl)-1-pyrrolidinyl]-3-methyl-1-oxo-2-butanyl}-2-pentylsuccinamide (CAS: 13434-13-4)?

This compound is primarily used in drug development for its potential pharmacological activities. It...

Compound Q&A

Is (2R)-N~4~-Hydroxy-N~1~-{(2S)-1-[(2S)-2-(hydroxymethyl)-1-pyrrolidinyl]-3-methyl-1-oxo-2-butanyl}-2-pentylsuccinamide (CAS: 13434-13-4) safe?

The compound is generally considered safe under normal handling conditions. However, it is important...

Compound Q&A

How should (2R)-N~4~-Hydroxy-N~1~-{(2S)-1-[(2S)-2-(hydroxymethyl)-1-pyrrolidinyl]-3-methyl-1-oxo-2-butanyl}-2-pentylsuccinamide (CAS: 13434-13-4) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...