Compound Q&A

What industries use 2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate (CAS: 741737-30-4)?

Answer

2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate
2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate is used in the pharmaceutical industry for the synthesis of certain drugs. It also has applications in the polymer industry for the development of specific polymer materials. Additionally, it can be found in sensor technologies and semiconductor manufacturing processes due to its unique chemical properties.

About

English Name 2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate
Molecular Formula C11H19NO3
Molecular Weight 213.28 g/mol
SMILES CC1C(=O)CCCN1C(=O)OC(C)(C)C
InChIKey GZOHWMOHDHOZOR-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate (CAS: 741737-30-4)?

2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate is a crystalline compound with a molecula...

Compound Q&A

How is 2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate (CAS: 741737-30-4) typically synthesized?

2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate is commonly synthesized through a multi-s...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate (CAS: 741737-30-4)?

When handling 2-Methyl-2-propanyl 2-methyl-3-oxo-1-piperidinecarboxylate, it is important to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...