Compound Q&A

What are the physical and chemical properties of 2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid (CAS: 552301-45-8)?

Answer

2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid
2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid is a white crystalline solid with a molecular weight of approximately 288.35 g/mol. It has a pKa of around 7.2 and is slightly soluble in water. The compound is reactive towards nucleophiles and can undergo esterification and condensation reactions.

About

English Name 2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid
Molecular Formula C12H16O3
Molecular Weight 208.26 g/mol
SMILES CC(C)(c1ccc(cc1)CCO)C(=O)O
InChIKey CHSAZBMOBSHGFV-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid (CAS: 552301-45-8) typically synthesized?

2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid is commonly synthesized through the reaction of ...

Compound Q&A

What industries use 2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid (CAS: 552301-45-8)?

2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid is used in the pharmaceutical industry as a prec...

Compound Q&A

What precautions should be taken when handling 2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid (CAS: 552301-45-8)?

When handling 2-[4-(2-Hydroxyethyl)phenyl]-2-methylpropanoic acid, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...