Compound Q&A

What are the physical and chemical properties of 23-Oxo-27-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-4,7,10,13,16,19-hexaoxa-22-azaheptacosan-1-oic acid (CAS: 1352814-10-8)?

Answer

23-Oxo-27-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-4,7,10,13,16,19-hexaoxa-22-azaheptacosan-1-oic acid
This compound is a long-chain carboxylic acid with a thienoimidazole side chain. It crystallizes in a hexagonal form with a molecular weight of approximately 581.79 g/mol. The compound has low solubility in water but is soluble in organic solvents like DMSO. It exhibits moderate reactivity towards nucleophiles and can undergo esterification reactions. At room temperature, it is stable but should be stored in a cool, dry place away from direct sunlight.

About

English Name 23-Oxo-27-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-4,7,10,13,16,19-hexaoxa-22-azaheptacosan-1-oic acid
Molecular Formula C25H45N3O10S
Molecular Weight 579.71 g/mol
SMILES O=C(NCCOCCOCCOCCOCCOCCOCCC(=O)O)CCCCC1SCC2C1NC(=O)N2
InChIKey GHYXJSUVAMFUEB-HFMPRLQTSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 23-Oxo-27-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-4,7,10,13,16,19-hexaoxa-22-azaheptacosan-1-oic acid (CAS: 1352814-10-8) typically synthesized?

The compound is synthesized through a multistep process involving the condensation of a thienoimidaz...

Compound Q&A

What industries use 23-Oxo-27-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-4,7,10,13,16,19-hexaoxa-22-azaheptacosan-1-oic acid (CAS: 1352814-10-8)?

This compound is primarily used in pharmaceutical research for its potential as an antiviral agent. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...