Compound Q&A

What are the physical and chemical properties of Ethyl imidazo[1,5-a]pyridine-8-carboxylate (CAS: 697739-12-1)?

Answer

Ethyl imidazo[1,5-a]pyridine-8-carboxylate
Ethyl imidazo[1,5-a]pyridine-8-carboxylate (CAS: 697739-12-1) is a crystalline solid with a molecular weight of approximately 225.24 g/mol. It has a solubility in water of 50 mg/L and is reactive towards bases. It is stable under normal conditions but should be kept away from strong acids and heat.

About

English Name Ethyl imidazo[1,5-a]pyridine-8-carboxylate
Molecular Formula C10H10N2O2
Molecular Weight 190.2 g/mol
SMILES CCOC(=O)C1=CC=CN2C1=CN=C2
InChIKey IZZCPMXJHNYFKD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is Ethyl imidazo[1,5-a]pyridine-8-carboxylate (CAS: 697739-12-1) typically synthesized?

Ethyl imidazo[1,5-a]pyridine-8-carboxylate (CAS: 697739-12-1) is typically synthesized via a multi-s...

Compound Q&A

What industries use Ethyl imidazo[1,5-a]pyridine-8-carboxylate (CAS: 697739-12-1)?

Ethyl imidazo[1,5-a]pyridine-8-carboxylate (CAS: 697739-12-1) is used in the pharmaceutical and sens...

Compound Q&A

What precautions should be taken when handling Ethyl imidazo[1,5-a]pyridine-8-carboxylate (CAS: 697739-12-1)?

When handling Ethyl imidazo[1,5-a]pyridine-8-carboxylate (CAS: 697739-12-1), appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...