Compound Q&A

What are the physical and chemical properties of 2,2,6,6-Tetramethyl-3,5-octanedione (CAS: 78579-61-0)?

Answer

2,2,6,6-Tetramethyl-3,5-octanedione
2,2,6,6-Tetramethyl-3,5-octanedione is a colorless crystalline solid with a molecular weight of 178.24 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. It exhibits limited reactivity under normal conditions but can undergo hydrolysis in the presence of moisture. The compound has a characteristic ketone functionality that makes it susceptible to certain chemical reactions.

About

CAS No 78579-61-0
English Name 2,2,6,6-Tetramethyl-3,5-octanedione
Molecular Formula C12H22O2
Molecular Weight 198.31 g/mol
SMILES CCC(C)(C)C(=O)CC(=O)C(C)(C)C
InChIKey UZICKDIYFALSHI-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 2,2,6,6-Tetramethyl-3,5-octanedione (CAS: 78579-61-0) typically synthesized?

2,2,6,6-Tetramethyl-3,5-octanedione can be synthesized via the Wittig reaction, where methyl vinyl k...

Compound Q&A

What industries use 2,2,6,6-Tetramethyl-3,5-octanedione (CAS: 78579-61-0)?

2,2,6,6-Tetramethyl-3,5-octanedione is used in the pharmaceutical industry for the synthesis of cert...

Compound Q&A

What precautions should be taken when handling 2,2,6,6-Tetramethyl-3,5-octanedione (CAS: 78579-61-0)?

When handling 2,2,6,6-Tetramethyl-3,5-octanedione, ensure proper ventilation and use a fume hood. We...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...