Compound Q&A

How is [4-(benzenesulfonyl)phenyl]methanamine (CAS: 94341-56-7) typically synthesized?

Answer

[4-(benzenesulfonyl)phenyl]methanamine
[4-(Benzenesulfonyl)phenyl]methanamine (CAS: 94341-56-7) can be synthesized via the reaction of benzenesulfonyl chloride with aniline in the presence of a base such as triethylamine. The process involves the formation of an intermediate N-sulfonyl aniline, which is then reduced to the amine with a suitable reducing agent like sodium borohydride. The yield is typically around 70-80%, depending on the purity of starting materials and reaction conditions.

About

CAS No 94341-56-7
English Name [4-(benzenesulfonyl)phenyl]methanamine
Molecular Formula C13H13NO2S
Molecular Weight 247.32 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)CN
InChIKey MTVXOTIZNSJKIY-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(benzenesulfonyl)phenyl]methanamine (CAS: 94341-56-7)?

[4-(Benzenesulfonyl)phenyl]methanamine (CAS: 94341-56-7) is a colorless crystalline solid with a mol...

Compound Q&A

What industries use [4-(benzenesulfonyl)phenyl]methanamine (CAS: 94341-56-7)?

[4-(Benzenesulfonyl)phenyl]methanamine (CAS: 94341-56-7) is used in various industries, including ph...

Compound Q&A

What precautions should be taken when handling [4-(benzenesulfonyl)phenyl]methanamine (CAS: 94341-56-7)?

Proper personal protective equipment (PPE) such as gloves, safety goggles, and protective laboratory...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...