Compound Q&A

What is the market or research trend for (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid (CAS: 158722-22-6)?

Answer

(4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid
The market for (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid (CAS: 158722-22-6) is primarily driven by its applications in pharmaceuticals, where it serves as a key intermediate in the synthesis of certain drugs. Recent research trends indicate an increasing focus on its use in drug discovery and development, particularly for treating inflammatory and autoimmune diseases. Additionally, there is growing interest in its potential use in the development of new antimicrobial agents.

About

English Name (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid
Molecular Formula C16H13NO3
Molecular Weight 267.28 g/mol
SMILES C1=CC=C(C=C1)C2C(OC(=N2)C3=CC=CC=C3)C(=O)O
InChIKey BPBOFBFRBITMMR-UONOGXRCSA-N
Last Updated: 2025-11-14 19:17

Related Q&A

Compound Q&A

What regulatory guidelines apply to (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid (CAS: 158722-22-6)?

The (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid (CAS: 158722-22-6) falls under the sco...

Compound Q&A

Are there alternatives to (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid in synthesis?

While (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid (CAS: 158722-22-6) is a specific com...

Compound Q&A

How should waste containing (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid (CAS: 158722-22-6) be handled?

Waste containing (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid (CAS: 158722-22-6) should...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...