Compound Q&A

Are there alternatives to 5-Benzyloxy-1-boc-indole-2-boronic acid (CAS: 850568-62-6) in synthesis?

Answer

5-Benzyloxy-1-boc-indole-2-boronic acid
Alternatives to 5-Benzyloxy-1-boc-indole-2-boronic acid (CAS: 850568-62-6) include other boronic acids and derivatives of indoles, such as 1-benzyl-2-boronic acid or 5-hydroxy-1-boc-indole-2-boronic acid. These can serve as effective substitutes in various synthetic reactions, depending on the specific requirements of the synthesis.

About

English Name 5-Benzyloxy-1-boc-indole-2-boronic acid
Molecular Formula C20H22BNO5
Molecular Weight 367.21 g/mol
SMILES B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)OCC3=CC=CC=C3)(O)O
InChIKey IQKGFXDPCFAYFP-UHFFFAOYSA-N
Last Updated: 2025-11-14 19:17

Related Q&A

Compound Q&A

What regulatory guidelines apply to 5-Benzyloxy-1-boc-indole-2-boronic acid (CAS: 850568-62-6)?

5-Benzyloxy-1-boc-indole-2-boronic acid (CAS: 850568-62-6) is subject to regulatory guidelines under...

Compound Q&A

What is the market or research trend for 5-Benzyloxy-1-boc-indole-2-boronic acid (CAS: 850568-62-6)?

The market trend for 5-Benzyloxy-1-boc-indole-2-boronic acid (CAS: 850568-62-6) is driven by its use...

Compound Q&A

How should waste containing 5-Benzyloxy-1-boc-indole-2-boronic acid (CAS: 850568-62-6) be handled?

Waste containing 5-Benzyloxy-1-boc-indole-2-boronic acid (CAS: 850568-62-6) should be collected in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...