Compound Q&A

Are there alternatives to (1R,2R)-N,N'-Dimethyl-N,N’-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine (CAS: 644958-86-1) in synthesis?

Answer

(1R,2R)-N,N'-Dimethyl-N,N’-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine
Alternative reagents such as other amines or diamines can be used, depending on the specific reaction conditions. For example, ethylenediamine or bis(3,3-dimethylbutyl)amine can serve as substitutes, offering similar functionalities but with different chemical structures.

About

English Name (1R,2R)-N,N'-Dimethyl-N,N’-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine
Molecular Formula C20H42N2
Molecular Weight 310.57 g/mol
SMILES CN(CCC(C)(C)C)[C@H]1[C@H](N(CCC(C)(C)C)C)CCCC1
InChIKey VGCWVKVNKNXOGZ-QZTJIDSGSA-N
Last Updated: 2025-11-14 19:17

Related Q&A

Compound Q&A

What regulatory guidelines apply to (1R,2R)-N,N'-Dimethyl-N,N’-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine (CAS: 644958-86-1)?

This compound falls under the scope of the REACH regulations in Europe and is subject to the U.S. EP...

Compound Q&A

What is the market or research trend for (1R,2R)-N,N'-Dimethyl-N,N’-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine (CAS: 644958-86-1)?

The market for this compound is growing due to its use in various applications, including pharmaceut...

Compound Q&A

How should waste containing (1R,2R)-N,N'-Dimethyl-N,N’-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine (CAS: 644958-86-1) be handled?

Waste containing this compound should be collected in sealed, labeled containers and stored in a wel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...