Compound Q&A

What is 1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione (CAS: 84-82-2)?

Answer

1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione
1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione is a heterocyclic compound with the CAS number 84-82-2. It is characterized by its molecular structure, which includes a pyrimidine and a triazine ring system, with two methyl groups attached to the ring. This compound possesses unique chemical properties, making it useful in various applications.

About

CAS No 84-82-2
English Name 1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione
Molecular Formula C7H7N5O2
Molecular Weight 193.17 g/mol
SMILES Cn1c(=O)c-2ncnn(c2nc1=O)C
InChIKey SLGRAIAQIAUZAQ-UHFFFAOYSA-N
Last Updated: 2025-11-12 20:36

Related Q&A

Compound Q&A

What are the main uses of 1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione (CAS: 84-82-2)?

1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione (CAS: 84-82-2) finds applications in the...

Compound Q&A

Is 1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione (CAS: 84-82-2) safe?

1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione (CAS: 84-82-2) is considered generally s...

Compound Q&A

How should 1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione (CAS: 84-82-2) be stored?

1,6-Dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione (CAS: 84-82-2) should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...