Compound Q&A

How should Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate (CAS: 157356-73-5) be stored?

Answer

Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate
Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate (CAS: 157356-73-5) should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to maintain its stability and prevent degradation. Storage should be at room temperature (15-25°C) to ensure its effectiveness and safety.

About

English Name Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate
Molecular Formula C12H18N2O2
Molecular Weight 222.29 g/mol
SMILES CCOC(=O)c1[nH]c(nc1C(=C)C)CCC
InChIKey IEJYWOUUSSOSKC-UHFFFAOYSA-N
Last Updated: 2025-11-12 20:35

Related Q&A

Compound Q&A

What is Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate (CAS: 157356-73-5)?

Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate (CAS: 157356-73-5) is a chemical compound wi...

Compound Q&A

What are the main uses of Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate (CAS: 157356-73-5)?

Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate (CAS: 157356-73-5) is primarily used as a pr...

Compound Q&A

Is Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate (CAS: 157356-73-5) safe?

Ethyl 4-isopropenyl-2-propyl-1H-imidazole-5-carboxylate (CAS: 157356-73-5) is generally considered s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...