Compound Q&A

What is 2,4-Dichloro-6-(trifluoromethyl)quinazoline (CAS: 864291-30-5)?

Answer

2,4-Dichloro-6-(trifluoromethyl)quinazoline
2,4-Dichloro-6-(trifluoromethyl)quinazoline is a chemical compound with the CAS number 864291-30-5. It is a quinazoline derivative with a 2,4-dichloro and trifluoromethyl substituent. This compound is characterized by its aromatic properties and is used in various applications including pharmaceuticals and research.

About

English Name 2,4-Dichloro-6-(trifluoromethyl)quinazoline
Molecular Formula C9H3Cl2F3N2
Molecular Weight 267.04 g/mol
SMILES C1=CC2=C(C=C1C(F)(F)F)C(=NC(=N2)Cl)Cl
InChIKey LHVPNHJCJOCBIS-UHFFFAOYSA-N
Last Updated: 2025-11-12 11:45

Related Q&A

Compound Q&A

What are the main uses of 2,4-Dichloro-6-(trifluoromethyl)quinazoline (CAS: 864291-30-5)?

2,4-Dichloro-6-(trifluoromethyl)quinazoline is primarily used in pharmaceutical research for its pot...

Compound Q&A

Is 2,4-Dichloro-6-(trifluoromethyl)quinazoline (CAS: 864291-30-5) safe?

2,4-Dichloro-6-(trifluoromethyl)quinazoline is not inherently safe and requires strict handling proc...

Compound Q&A

How should 2,4-Dichloro-6-(trifluoromethyl)quinazoline (CAS: 864291-30-5) be stored?

2,4-Dichloro-6-(trifluoromethyl)quinazoline should be stored in a cool, dry place away from direct s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...