Compound Q&A

What is 2-Hydroxypropanoic acid - 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile (CAS: 100286-97-3)?

Answer

2-Hydroxypropanoic acid - 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile (1:1)
2-Hydroxypropanoic acid - 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile (CAS: 100286-97-3) is a complex organic compound with a unique structure combining a bipyridine moiety and a carboxamide group. It appears as a solid and is known for its stability and potential in various applications.

About

English Name 2-Hydroxypropanoic acid - 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile (1:1)
Molecular Formula C15H15N3O4
Molecular Weight 107.11 g/mol
SMILES CC1=C(C=C(C(=O)N1)C#N)C2=CC=NC=C2.CC(C(=O)O)O
InChIKey VWUPWEAFIOQCGF-UHFFFAOYSA-N
Last Updated: 2025-11-12 11:45

Related Q&A

Compound Q&A

What are the main uses of 2-Hydroxypropanoic acid - 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile (CAS: 100286-97-3)?

This compound is primarily used in pharmaceuticals for its potential as a drug candidate, in researc...

Compound Q&A

Is 2-Hydroxypropanoic acid - 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile (CAS: 100286-97-3) safe?

2-Hydroxypropanoic acid - 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile is generally con...

Compound Q&A

How should 2-Hydroxypropanoic acid - 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile (CAS: 100286-97-3) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. It is recommended to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...