Compound Q&A

What are the main uses of 5-Bromo-2-fluoro-3-methylphenylboronic acid (CAS: 957120-61-5)?

Answer

5-Bromo-2-fluoro-3-methylphenylboronic acid
5-Bromo-2-fluoro-3-methylphenylboronic acid is primarily used in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. It serves as a protective group in the synthesis of functional groups and is also used in the preparation of boronic esters and boronate esters for various chemical transformations.

About

English Name 5-Bromo-2-fluoro-3-methylphenylboronic acid
Molecular Formula C7H7BBrFO2
Molecular Weight 232.84 g/mol
SMILES B(C1=CC(=CC(=C1F)C)Br)(O)O
InChIKey VLFDXHTXMHURJH-UHFFFAOYSA-N
Last Updated: 2025-11-12 11:45

Related Q&A

Compound Q&A

What is 5-Bromo-2-fluoro-3-methylphenylboronic acid (CAS: 957120-61-5)?

5-Bromo-2-fluoro-3-methylphenylboronic acid is an organoboron compound with the molecular formula C9...

Compound Q&A

Is 5-Bromo-2-fluoro-3-methylphenylboronic acid (CAS: 957120-61-5) safe?

5-Bromo-2-fluoro-3-methylphenylboronic acid is generally safe when handled with appropriate precauti...

Compound Q&A

How should 5-Bromo-2-fluoro-3-methylphenylboronic acid (CAS: 957120-61-5) be stored?

5-Bromo-2-fluoro-3-methylphenylboronic acid should be stored in a cool, dry place away from direct s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...