Compound Q&A

Are there alternatives to 1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1) (CAS: 222159-87-7) in synthesis?

Answer

1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1)
There are alternative reagents that can be used in synthesis, such as 5-aminovaleric acid and various diones. Isomers and analogs like 1-(5-amino-1-pentenyl)-1H-pyrrole-2,5-dione trifluoroacetate can also be considered based on the specific requirements of the synthesis. The choice often depends on the desired product properties and reaction conditions.

About

English Name 1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1)
Molecular Formula C11H15F3N2O4
Molecular Weight 296.24 g/mol
SMILES C1=CC(=O)N(C1=O)CCCCCN.C(=O)(C(F)(F)F)O
InChIKey LJWKDXOJBJSKTA-UHFFFAOYSA-N
Last Updated: 2025-11-12 07:35

Related Q&A

Compound Q&A

What regulatory guidelines apply to 1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1) (CAS: 222159-87-7)?

1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1) (CAS: 222159-87-7) falls under several...

Compound Q&A

What is the market or research trend for 1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1) (CAS: 222159-87-7)?

The market for 1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1) (CAS: 222159-87-7) is g...

Compound Q&A

How should waste containing 1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1) (CAS: 222159-87-7) be handled?

Waste containing 1-(5-Aminopentyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1) (CAS: 222159-87-7) sh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...