Compound Q&A

Are there alternatives to BacopasideN2 (CAS: 871706-75-1) in synthesis?

Answer

BacopasideN2
BacopasideN2 (CAS: 871706-75-1) can be synthesized using various methodologies, and there are alternative reagents and approaches that can be employed. For instance, related compounds like bacopasides or other flavonoids can serve as effective alternatives. Additionally, alternative synthetic routes such as one-pot reactions or different starting materials can be considered to achieve similar or different functional groups, depending on the specific requirements of the product.

About

English Name BacopasideN2
Molecular Formula C42H68O14
Molecular Weight 796.98 g/mol
SMILES CC(C)=C[C@@H]1CO[C@]23C[C@]4(CO2)[C@H](CC[C@@H]2[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H]6O)C(C)(C)[C@@H]5CC[C@]24C)[C@H]3[C@@]1(C)O
InChIKey DQBAJFFGCXINLY-ZGAWJQKFSA-N
Last Updated: 2025-11-12 07:35

Related Q&A

Compound Q&A

What regulatory guidelines apply to BacopasideN2 (CAS: 871706-75-1)?

BacopasideN2 (CAS: 871706-75-1) falls under the jurisdiction of the Globally Harmonized System of Cl...

Compound Q&A

What is the market or research trend for BacopasideN2 (CAS: 871706-75-1)?

The market for BacopasideN2 (CAS: 871706-75-1) is primarily driven by its potential as a bioactive c...

Compound Q&A

How should waste containing BacopasideN2 (CAS: 871706-75-1) be handled?

Waste containing BacopasideN2 (CAS: 871706-75-1) should be collected in appropriate, leak-proof cont...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...