Compound Q&A

Are there alternatives to 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 144060-99-1) in synthesis?

Answer

2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid
There are alternative reagents that can be used in the synthesis of 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 144060-99-1), such as other thiazole derivatives or related heterocycles. Analogous compounds, isomers, and other substituted derivatives might also serve as effective alternatives, depending on the specific synthetic pathway and desired properties.

About

English Name 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid
Molecular Formula C11H8FNO2S
Molecular Weight 237.26 g/mol
SMILES CC1=C(SC(=N1)C2=CC=C(C=C2)F)C(=O)O
InChIKey LPBSLIRPWIFCQT-UHFFFAOYSA-N
Last Updated: 2025-11-12 07:35

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 144060-99-1)?

2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 144060-99-1) is regulated under the...

Compound Q&A

What is the market or research trend for 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 144060-99-1)?

The market for 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 144060-99-1) is grow...

Compound Q&A

How should waste containing 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 144060-99-1) be handled?

Waste containing 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 144060-99-1) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...