Compound Q&A

Are there alternatives to 3'-Adenylic acid (CAS: 84-21-9) in synthesis?

Answer

3'-Adenylic acid
There are several alternatives to 3'-Adenylic acid (CAS: 84-21-9) used in synthesis, depending on the specific application. For instance, other nucleosides such as 2'-Adenylic acid or other adenosine derivatives may serve similar functions. Additionally, isomers or analogs like 5'-Adenylic acid can be used as alternatives. In some cases, synthetic intermediates such as inosine can be used as a precursor. It is essential to consider the specific requirements of the synthesis and the desired properties of the final product when selecting an alternative.

About

CAS No 84-21-9
English Name 3'-Adenylic acid
Molecular Formula C10H14N5O7P
Molecular Weight 347.22 g/mol
SMILES OC[C@@H]1[C@@H](OP(O)(O)=O)[C@H]([C@H](N2C=NC3=C2N=CN=C3N)O1)O
InChIKey LNQVTSROQXJCDD-KQYNXXCUSA-N
Last Updated: 2025-11-11 20:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3'-Adenylic acid (CAS: 84-21-9)?

3'-Adenylic acid (CAS: 84-21-9) falls under the scope of various regulatory guidelines. It is classi...

Compound Q&A

What is the market or research trend for 3'-Adenylic acid (CAS: 84-21-9)?

The market for 3'-Adenylic acid (CAS: 84-21-9) is primarily driven by its applications in research a...

Compound Q&A

How should waste containing 3'-Adenylic acid (CAS: 84-21-9) be handled?

Waste containing 3'-Adenylic acid (CAS: 84-21-9) should be handled with caution to ensure environmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...