Compound Q&A

Are there alternatives to 4-Bromo-2-fluoro-3-methoxybenzoic acid in synthesis?

Answer

4-Bromo-2-fluoro-3-methoxybenzoic acid
For synthesis, alternatives to 4-Bromo-2-fluoro-3-methoxybenzoic acid (CAS: 194804-92-7) include other brominated and fluorinated benzoic acids, such as 2-bromo-3-methoxybenzoic acid or 3-bromo-2-fluoro-4-methoxybenzoic acid. These compounds can serve as effective substitutes depending on the specific reaction conditions and desired product.

About

English Name 4-Bromo-2-fluoro-3-methoxybenzoic acid
Molecular Formula C8H6BrFO3
Molecular Weight 249.03 g/mol
SMILES COC1=C(C=CC(=C1F)C(=O)O)Br
InChIKey FJOKKTOXWITJGO-UHFFFAOYSA-N
Last Updated: 2025-11-11 20:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-Bromo-2-fluoro-3-methoxybenzoic acid (CAS: 194804-92-7)?

4-Bromo-2-fluoro-3-methoxybenzoic acid (CAS: 194804-92-7) falls under GHS classification as a hazard...

Compound Q&A

What is the market or research trend for 4-Bromo-2-fluoro-3-methoxybenzoic acid (CAS: 194804-92-7)?

The market for 4-Bromo-2-fluoro-3-methoxybenzoic acid (CAS: 194804-92-7) is driven by its use in pha...

Compound Q&A

How should waste containing 4-Bromo-2-fluoro-3-methoxybenzoic acid (CAS: 194804-92-7) be handled?

Waste containing 4-Bromo-2-fluoro-3-methoxybenzoic acid (CAS: 194804-92-7) should be collected in ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...