Compound Q&A

Are there alternatives to 5-Phenyl-2-pyridinecarboxylic acid (CAS: 75754-04-0) in synthesis?

Answer

5-Phenyl-2-pyridinecarboxylic acid
While 5-Phenyl-2-pyridinecarboxylic acid (CAS: 75754-04-0) is a valuable compound for certain applications, there are alternatives such as 3-Phenyl-2-pyridinecarboxylic acid and its isomers. These can serve as effective substitutes in synthesis, depending on the specific requirements of the reaction and the desired product properties.

About

CAS No 75754-04-0
English Name 5-Phenyl-2-pyridinecarboxylic acid
Molecular Formula C12H9NO2
Molecular Weight 199.21 g/mol
SMILES C1=CC=C(C=C1)C2=CN=C(C=C2)C(=O)O
InChIKey CNCJXSKAKGXNKJ-UHFFFAOYSA-N
Last Updated: 2025-11-11 20:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to 5-Phenyl-2-pyridinecarboxylic acid (CAS: 75754-04-0)?

5-Phenyl-2-pyridinecarboxylic acid (CAS: 75754-04-0) should comply with the Globally Harmonized Syst...

Compound Q&A

What is the market or research trend for 5-Phenyl-2-pyridinecarboxylic acid (CAS: 75754-04-0)?

The market for 5-Phenyl-2-pyridinecarboxylic acid (CAS: 75754-04-0) is growing due to its applicatio...

Compound Q&A

How should waste containing 5-Phenyl-2-pyridinecarboxylic acid (CAS: 75754-04-0) be handled?

Waste containing 5-Phenyl-2-pyridinecarboxylic acid (CAS: 75754-04-0) should be collected in appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...