Compound Q&A

Are there alternatives to Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1) (CAS: 138182-20-4) in synthesis?

Answer

Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1)
Alternatives to Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1) (CAS: 138182-20-4) in synthesis include other indolyl derivatives with different functionalities, such as 6-halo-1H-indol-3-yl beta-D-glucopyranosiduronic acids. Commonly used alternative reagents include various halogenated indoles and other glucopyranosiduronic acid derivatives. These alternatives can provide similar or different reactivity profiles, depending on the specific synthetic needs.

About

English Name Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1)
Molecular Formula C20H27ClN2O7
Molecular Weight 442.9 g/mol
SMILES C1CCC(CC1)N.C1=CC2=C(C=C1Cl)NC=C2OC3C(C(C(C(O3)C(=O)O)O)O)O
InChIKey CGXWVPSZSVEFAI-CYRSAHDMSA-N
Last Updated: 2025-11-11 20:47

Related Q&A

Compound Q&A

What regulatory guidelines apply to Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1) (CAS: 138182-20-4)?

Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1) (CAS: 138182-20-4) f...

Compound Q&A

What is the market or research trend for Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1) (CAS: 138182-20-4)?

Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1) (CAS: 138182-20-4) i...

Compound Q&A

How should waste containing Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1) (CAS: 138182-20-4) be handled?

Waste containing Cyclohexanamine - 6-chloro-1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1) (CA...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...