Compound Q&A

Are there alternatives to Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS: 886361-98-4) in synthesis?

Answer

Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate
Alternative reagents to Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS: 886361-98-4) in synthesis include various imidazo derivatives and brominated compounds. Researchers often explore synthetic routes involving other bromoimidazoles or pyridine derivatives as suitable substitutes, depending on the specific reaction conditions and desired product properties. The choice of alternative reagents depends on the reactivity, cost, and availability.

About

English Name Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate
Molecular Formula C9H7BrN2O2
Molecular Weight 255.07 g/mol
SMILES COC(=O)C1=CN2C(=NC=C2Br)C=C1
InChIKey UZGCHIJIFAKVNH-UHFFFAOYSA-N
Last Updated: 2025-11-11 20:47

Related Q&A

Compound Q&A

What regulatory guidelines apply to Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS: 886361-98-4)?

Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS: 886361-98-4) is subject to various regulato...

Compound Q&A

What is the market or research trend for Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS: 886361-98-4)?

The market and research trend for Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS: 886361-98...

Compound Q&A

How should waste containing Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS: 886361-98-4) be handled?

Waste containing Methyl 3-Bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS: 886361-98-4) should be han...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...