Compound Q&A

Are there alternatives to 2-(5-Fluoro-1H-indazol-3-YL)acetic acid (CAS: 885271-22-7) in synthesis?

Answer

2-(5-Fluoro-1H-indazol-3-YL)acetic acid
In the synthesis of 2-(5-Fluoro-1H-indazol-3-YL)acetic acid (CAS: 885271-22-7), chemists may consider using analogous compounds like 2-(5-chloro-1H-indazol-3-yl)acetic acid or other related indazol derivatives. Additionally, alternative reagents such as fluoroacetic acid or other fluorinating agents can be explored as substitutes, depending on the specific reaction conditions and desired product structure.

About

English Name 2-(5-Fluoro-1H-indazol-3-YL)acetic acid
Molecular Formula C9H7FN2O2
Molecular Weight 194.17 g/mol
SMILES C1=CC2=NNC(=C2C=C1F)CC(=O)O
InChIKey MILWWVRZISGHQU-UHFFFAOYSA-N
Last Updated: 2025-11-11 15:25

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-(5-Fluoro-1H-indazol-3-YL)acetic acid (CAS: 885271-22-7)?

2-(5-Fluoro-1H-indazol-3-YL)acetic acid (CAS: 885271-22-7) is subject to various regulatory guidelin...

Compound Q&A

What is the market or research trend for 2-(5-Fluoro-1H-indazol-3-YL)acetic acid (CAS: 885271-22-7)?

The market and research trends for 2-(5-Fluoro-1H-indazol-3-YL)acetic acid (CAS: 885271-22-7) are cu...

Compound Q&A

How should waste containing 2-(5-Fluoro-1H-indazol-3-YL)acetic acid (CAS: 885271-22-7) be handled?

Waste containing 2-(5-Fluoro-1H-indazol-3-YL)acetic acid (CAS: 885271-22-7) should be collected in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...