Compound Q&A

What is the market or research trend for 3-(2-Bromo-1,3-thiazol-4-yl)pyridine (CAS: 886370-95-2)?

Answer

3-(2-Bromo-1,3-thiazol-4-yl)pyridine
The market and research trends for 3-(2-Bromo-1,3-thiazol-4-yl)pyridine (CAS: 886370-95-2) indicate a growing interest in its use as an intermediate in pharmaceutical and agrochemical industries. Its unique chemical structure makes it a valuable compound for developing new drugs and pesticides. Additionally, ongoing research focuses on its potential applications in medicinal chemistry and materials science, driving further exploration and development of its properties and uses.

About

English Name 3-(2-Bromo-1,3-thiazol-4-yl)pyridine
Molecular Formula C8H5BrN2S
Molecular Weight 241.11 g/mol
SMILES C1=CC(=CN=C1)C2=CSC(=N2)Br
InChIKey ITEDZSJFELWCCO-UHFFFAOYSA-N
Last Updated: 2025-11-08 12:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3-(2-Bromo-1,3-thiazol-4-yl)pyridine (CAS: 886370-95-2)?

3-(2-Bromo-1,3-thiazol-4-yl)pyridine (CAS: 886370-95-2) is regulated under the Globally Harmonized S...

Compound Q&A

Are there alternatives to 3-(2-Bromo-1,3-thiazol-4-yl)pyridine (CAS: 886370-95-2) in synthesis?

There are alternative reagents that can be used in synthesis to achieve similar molecular structures...

Compound Q&A

How should waste containing 3-(2-Bromo-1,3-thiazol-4-yl)pyridine (CAS: 886370-95-2) be handled?

Waste containing 3-(2-Bromo-1,3-thiazol-4-yl)pyridine (CAS: 886370-95-2) should be collected in appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...