Compound Q&A

What are the physical and chemical properties of 3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (CAS: 6469-93-8)?

Answer

3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (1:1)
3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (CAS: 6469-93-8) is a crystalline compound with a molecular weight of approximately 342.64 g/mol. It has a solubility in water of around 0.1 g/L at 25°C. The compound is stable under normal conditions but reacts with strong bases. It is insoluble in common organic solvents like ether and chloroform. This compound is often used in pharmaceutical applications due to its chemical reactivity.

About

CAS No 6469-93-8
English Name 3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (1:1)
Molecular Formula C18H19Cl2NS
Molecular Weight 352.33 g/mol
SMILES CN(C)CCC=C1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl.Cl
InChIKey YWKRLOSRDGPEJR-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (CAS: 6469-93-8) typically synthesized?

3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (CAS: 6469-93-8) is t...

Compound Q&A

What industries use 3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (CAS: 6469-93-8)?

3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (CAS: 6469-93-8) is p...

Compound Q&A

What precautions should be taken when handling 3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (CAS: 6469-93-8)?

When handling 3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine hydrochloride (CAS: 6...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...