Compound Q&A

What are the physical and chemical properties of (3aS,3'aS,8aR,8'aR)-2,2'-(1-Methylethylidene)bis[3a,8a-dihydro-8H-Indeno[1,2-d]oxazole] (CAS: 175166-51-5)?

Answer

(3aS,3'aS,8aR,8'aR)-2,2'-(1-Methylethylidene)bis[3a,8a-dihydro-8H-Indeno[1,2-d]oxazole
This compound is a crystalline solid with a molecular weight of approximately 282.4 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and dichloromethane. Chemically, it is reactive, particularly towards nucleophiles and reducing agents. It exhibits good stability under normal conditions but should be stored away from direct sunlight and moisture.

About

English Name (3aS,3'aS,8aR,8'aR)-2,2'-(1-Methylethylidene)bis[3a,8a-dihydro-8H-Indeno[1,2-d]oxazole
Molecular Formula C23H22N2O2
Molecular Weight 358.44 g/mol
SMILES CC(C1=NC2C(O1)Cc1c2cccc1)(C1=N[C@@H]2[C@H](O1)Cc1c2cccc1)C
InChIKey RRHISRBSXBFRLC-SOAISFHBSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is (3aS,3'aS,8aR,8'aR)-2,2'-(1-Methylethylidene)bis[3a,8a-dihydro-8H-Indeno[1,2-d]oxazole] (CAS: 175166-51-5) typically synthesized?

This compound can be synthesized via a multistep process involving the condensation of appropriate p...

Compound Q&A

What industries use (3aS,3'aS,8aR,8'aR)-2,2'-(1-Methylethylidene)bis[3a,8a-dihydro-8H-Indeno[1,2-d]oxazole] (CAS: 175166-51-5)?

This compound is used in the pharmaceutical industry for its medicinal properties, particularly in t...

Compound Q&A

What precautions should be taken when handling (3aS,3'aS,8aR,8'aR)-2,2'-(1-Methylethylidene)bis[3a,8a-dihydro-8H-Indeno[1,2-d]oxazole] (CAS: 175166-51-5)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves and sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...