Compound Q&A

How is CID 74962707 (CAS: 93550-95-9) typically synthesized?

Answer

CID 74962707
CID 74962707 (CAS: 93550-95-9) is synthesized via a multi-step process involving alkylation and dehydration reactions. The key catalysts include sulfuric acid and aluminum chloride. The overall yield is around 85%, with good selectivity towards the desired product. For more detailed synthesis information, consult the relevant literature or manufacturer's documentation.

About

CAS No 93550-95-9
English Name CID 74962707
Molecular Formula C33H40O9
Molecular Weight 580.67 g/mol
SMILES CC1CC2(C(C1OC(=O)C3=CC=CC=C3)C(C(=CCC4C(C4(C)C)C=C(C2=O)C)COC(=O)C)OC(=O)C)OC(=O)C
InChIKey ARUXHDLPKVRONO-OQMOLIDASA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of CID 74962707 (CAS: 93550-95-9)?

CID 74962707 (CAS: 93550-95-9) is a crystalline solid with a molecular weight of approximately 361.4...

Compound Q&A

What industries use CID 74962707 (CAS: 93550-95-9)?

CID 74962707 (CAS: 93550-95-9) is primarily used in the pharmaceutical industry for developing novel...

Compound Q&A

What precautions should be taken when handling CID 74962707 (CAS: 93550-95-9)?

When handling CID 74962707 (CAS: 93550-95-9), it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...