Compound Q&A

What are the physical and chemical properties of Ficusin A (CAS: 173429-83-9)?

Answer

Ficusin A
Ficusin A (CAS: 173429-83-9) is a semi-solid compound with a molecular weight of approximately 358.36 g/mol. It is poorly soluble in water but soluble in organic solvents such as methanol and ethanol. Ficusin A exhibits limited reactivity, making it stable under normal conditions but sensitive to strong acids and bases. It is also known for its high melting point and low volatility.

About

English Name Ficusin A
Molecular Formula C25H24O5
Molecular Weight 404.5 g/mol
SMILES CC1=CC(C(CC1)C(=C)C)C2=C(C=C(C3=C2OC=C(C3=O)C4=CC=C(C=C4)O)O)O
InChIKey LRYZMDSDXSWBMU-ZWKOTPCHSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is Ficusin A (CAS: 173429-83-9) typically synthesized?

Ficusin A (CAS: 173429-83-9) is synthesized through a multi-step process involving the condensation ...

Compound Q&A

What industries use Ficusin A (CAS: 173429-83-9)?

Ficusin A (CAS: 173429-83-9) finds applications in the pharmaceutical industry for its potential bio...

Compound Q&A

What precautions should be taken when handling Ficusin A (CAS: 173429-83-9)?

When handling Ficusin A (CAS: 173429-83-9), it is essential to use proper personal protective equipm...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...