Compound Q&A

What are the physical and chemical properties of Octyl Benzyl Phthalate (CAS: 1248-43-7)?

Answer

Octyl Benzyl Phthalate
Octyl Benzyl Phthalate (CAS: 1248-43-7) is a colorless to light yellow liquid with a slightly aromatic odor. Its molecular weight is approximately 256.33 g/mol. It has a high boiling point of around 325°C and a low melting point of -41°C. Soluble in common organic solvents like ethanol and acetone, but slightly soluble in water. Chemically, it is stable under normal conditions but can be hydrolyzed in strong bases or acids.

About

CAS No 1248-43-7
English Name Octyl Benzyl Phthalate
Molecular Formula C23H28O4
Molecular Weight 368.5 g/mol
SMILES CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCC2=CC=CC=C2
InChIKey WHHSHXMIKFVAEK-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is Octyl Benzyl Phthalate (CAS: 1248-43-7) typically synthesized?

Octyl Benzyl Phthalate (CAS: 1248-43-7) is synthesized through the esterification of phthalic anhydr...

Compound Q&A

What industries use Octyl Benzyl Phthalate (CAS: 1248-43-7)?

Octyl Benzyl Phthalate (CAS: 1248-43-7) is widely used in the plastic industry as a plasticizer, enh...

Compound Q&A

What precautions should be taken when handling Octyl Benzyl Phthalate (CAS: 1248-43-7)?

When handling Octyl Benzyl Phthalate (CAS: 1248-43-7), it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...