Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid (CAS: 22892-95-1)?

Answer

4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid
4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 334.01 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive due to the presence of the nitro and sulfonyl halide groups, which can participate in electrophilic aromatic substitution and nucleophilic substitution reactions.

About

CAS No 22892-95-1
English Name 4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid
Molecular Formula C7H3Cl2NO6S
Molecular Weight 300.07 g/mol
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])Cl)S(=O)(=O)Cl)C(=O)O
InChIKey AFRAGFLBINOHDV-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid (CAS: 22892-95-1) typically synthesized?

4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid is commonly synthesized through a multistep process ...

Compound Q&A

What industries use 4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid (CAS: 22892-95-1)?

4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid (CAS: 22892-95-1)?

When handling 4-Chloro-3-(chlorosulfonyl)-5-nitrobenzoic acid, it is essential to use appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...