Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate (CAS: 871115-54-7)?

Answer

2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate is a colorless crystalline solid with a molecular weight of approximately 245.25 g/mol. It has a high solubility in organic solvents such as methanol and ethanol, but is poorly soluble in water. This compound is known for its reactivity, particularly in nucleophilic substitution and condensation reactions.

About

English Name 2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate
Molecular Formula C10H17N3O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)(C#N)N
InChIKey NFLVTBMZGLRSPT-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate (CAS: 871115-54-7) typically synthesized?

2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate is typically synthesized through a mult...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate (CAS: 871115-54-7)?

2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate (CAS: 871115-54-7)?

When handling 2-Methyl-2-propanyl 3-amino-3-cyano-1-pyrrolidinecarboxylate, it is important to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...